| MolName | N-[(Z)-[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| MolecularFormula | C29H23N3O3 |
| Smiles | N#Cc1c(COc2ccc(/C=N\NC(C(c3ccccc3)(c3ccccc3)O)=O)cc2)cccc1 |
| InChI | InChI=1S/C29H23N3O3/c30-19-23-9-7-8-10-24(23)21-35-27-17-15-22(16-18-27)20-31-32-28(33)29(34,25-11-3-1-4-12-25)26-13-5-2-6-14-26/h1-18,20,34H,21H2,(H,32,33) |
| InChIK | JPROBAVYEDOIBJ-UHFFFAOYSA-N |
| TotalMolweight | 461.52 |
| Molweight | 461.52 |
| MonoisotopicMass | 461.173942 |
| CLogP | 4.6656 |
| CLogS | -6.541 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 368.74 |
| Relative PSA | 0.19708 |
| PolarSurfaceArea | 94.71 |
| Druglikeness | 0.84667 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide | 2 - N-[(Z)-[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide