| MolName | 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzamide |
| MolecularFormula | C20H14N3O3Cl3S |
| Smiles | O=C(c1cc(S(Nc(cc2)ccc2Cl)(=O)=O)ccc1)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C20H14Cl3N3O3S/c21-15-6-8-17(9-7-15)26-30(28,29)18-3-1-2-13(10-18)20(27)25-24-12-14-4-5-16(22)11-19(14)23/h1-12,26H,(H,25,27) |
| InChIK | JQJMRAAYMWFQBY-UHFFFAOYSA-N |
| TotalMolweight | 482.774 |
| Molweight | 482.774 |
| MonoisotopicMass | 480.982143 |
| CLogP | 5.3187 |
| CLogS | -7.262 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 333.05 |
| Relative PSA | 0.22834 |
| PolarSurfaceArea | 96.01 |
| Druglikeness | 2.4732 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzamide | 2 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]benzamide