| MolName | 2-(2-cyanophenoxy)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide |
| MolecularFormula | C18H15N3O2 |
| Smiles | N#Cc(cccc1)c1OCC(N/N=C\C=C\c1ccccc1)=O |
| InChI | InChI=1S/C18H15N3O2/c19-13-16-10-4-5-11-17(16)23-14-18(22)21-20-12-6-9-15-7-2-1-3-8-15/h1-12H,14H2,(H,21,22) |
| InChIK | JQKZBTJPRJBNDV-UHFFFAOYSA-N |
| TotalMolweight | 305.336 |
| Molweight | 305.336 |
| MonoisotopicMass | 305.116427 |
| CLogP | 2.6304 |
| CLogS | -4.566 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 258.96 |
| Relative PSA | 0.23004 |
| PolarSurfaceArea | 74.48 |
| Druglikeness | -0.022433 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-cyanophenoxy)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide | 2 - 2-(2-cyanophenoxy)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]acetamide