| MolName | 4-hydroxy-N-[(Z)-[1-(4-nitrophenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzamide |
| MolecularFormula | C23H17N5O4 |
| Smiles | [O-][N+](c(cc1)ccc1-n(cc1/C=N\NC(c(cc2)ccc2O)=O)nc1-c1ccccc1)=O |
| InChI | InChI=1S/C23H17N5O4/c29-21-12-6-17(7-13-21)23(30)25-24-14-18-15-27(19-8-10-20(11-9-19)28(31)32)26-22(18)16-4-2-1-3-5-16/h1-15,29H,(H,25,30) |
| InChIK | JRCKNEFQOWHRAE-UHFFFAOYSA-N |
| TotalMolweight | 427.419 |
| Molweight | 427.419 |
| MonoisotopicMass | 427.128055 |
| CLogP | 2.8533 |
| CLogS | -5.398 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 324.49 |
| Relative PSA | 0.30007 |
| PolarSurfaceArea | 125.33 |
| Druglikeness | 0.74521 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-hydroxy-N-[(Z)-[1-(4-nitrophenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzamide | 2 - 4-hydroxy-N-[(Z)-[1-(4-nitrophenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzamide