| MolName | 5-amino-N-[(Z)-benzylideneamino]-3-(4-chlorophenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxamide |
| MolecularFormula | C20H14N5O2ClS |
| Smiles | Nc(scc1C(C(N/N=C\c2ccccc2)=O)=NN2c(cc3)ccc3Cl)c1C2=O |
| InChI | InChI=1S/C20H14ClN5O2S/c21-13-6-8-14(9-7-13)26-20(28)16-15(11-29-18(16)22)17(25-26)19(27)24-23-10-12-4-2-1-3-5-12/h1-11H,22H2,(H,24,27) |
| InChIK | JRMLDVYNXVHMFG-UHFFFAOYSA-N |
| TotalMolweight | 423.883 |
| Molweight | 423.883 |
| MonoisotopicMass | 423.055672 |
| CLogP | 4.117 |
| CLogS | -6.134 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 304.15 |
| Relative PSA | 0.32793 |
| PolarSurfaceArea | 128.39 |
| Druglikeness | 7.3049 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 5-amino-N-[(Z)-benzylideneamino]-3-(4-chlorophenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxamide | 2 - 5-amino-N-[(Z)-benzylideneamino]-3-(4-chlorophenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxamide