| MolName | (E)-N-(2,4-dichlorophenyl)-3-phenylprop-2-en-1-imine |
| MolecularFormula | C15H11NCl2 |
| Smiles | Clc(cc1)cc(Cl)c1/N=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H11Cl2N/c16-13-8-9-15(14(17)11-13)18-10-4-7-12-5-2-1-3-6-12/h1-11H |
| InChIK | JRQNHNAYVXGQBB-UHFFFAOYSA-N |
| TotalMolweight | 276.165 |
| Molweight | 276.165 |
| MonoisotopicMass | 275.026853 |
| CLogP | 4.2637 |
| CLogS | -4.922 |
| H Acceptors | 1 |
| TotalSurfaceArea | 215.12 |
| Relative PSA | 0.053505 |
| PolarSurfaceArea | 12.36 |
| Druglikeness | -0.059853 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.72222 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - (E)-N-(2,4-dichlorophenyl)-3-phenylprop-2-en-1-imine | 2 - (E)-N-(2,4-dichlorophenyl)-3-phenylprop-2-en-1-imine