| MolName | 1-(2,4-dichlorophenyl)-3-[(Z)-thiophen-3-ylmethylideneamino]thiourea |
| MolecularFormula | C12H9N3Cl2S2 |
| Smiles | S=C(Nc(ccc(Cl)c1)c1Cl)N/N=C\c1cscc1 |
| InChI | InChI=1S/C12H9Cl2N3S2/c13-9-1-2-11(10(14)5-9)16-12(18)17-15-6-8-3-4-19-7-8/h1-7H,(H2,16,17,18) |
| InChIK | JRSMUPSBSZLTGK-UHFFFAOYSA-N |
| TotalMolweight | 330.262 |
| Molweight | 330.262 |
| MonoisotopicMass | 328.961491 |
| CLogP | 4.5886 |
| CLogS | -5.693 |
| H Acceptors | 3 |
| H Donors | 2 |
| TotalSurfaceArea | 240.19 |
| Relative PSA | 0.34469 |
| PolarSurfaceArea | 96.75 |
| Druglikeness | 2.9577 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2,4-dichlorophenyl)-3-[(Z)-thiophen-3-ylmethylideneamino]thiourea | 2 - 1-(2,4-dichlorophenyl)-3-[(Z)-thiophen-3-ylmethylideneamino]thiourea