| MolName | N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]furan-2-carboxamide |
| MolecularFormula | C26H19N3O2 |
| Smiles | O=C(c1ccco1)N/N=C\c(c1c2cccc1)c(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C26H19N3O2/c30-26(24-16-9-17-31-24)28-27-18-22-21-14-7-8-15-23(21)29(20-12-5-2-6-13-20)25(22)19-10-3-1-4-11-19/h1-18H,(H,28,30) |
| InChIK | JRWPNQPPRXGTJC-UHFFFAOYSA-N |
| TotalMolweight | 405.456 |
| Molweight | 405.456 |
| MonoisotopicMass | 405.147727 |
| CLogP | 5.6423 |
| CLogS | -8.995 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 320 |
| Relative PSA | 0.17809 |
| PolarSurfaceArea | 59.53 |
| Druglikeness | 5.2921 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.45161 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]furan-2-carboxamide | 2 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]furan-2-carboxamide