| MolName | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-4-(morpholin-4-ylmethyl)benzamide |
| MolecularFormula | C19H19N3O2Cl2 |
| Smiles | O=C(c1ccc(CN2CCOCC2)cc1)N/N=C\c(c(Cl)ccc1)c1Cl |
| InChI | InChI=1S/C19H19Cl2N3O2/c20-17-2-1-3-18(21)16(17)12-22-23-19(25)15-6-4-14(5-7-15)13-24-8-10-26-11-9-24/h1-7,12H,8-11,13H2,(H,23,25) |
| InChIK | JSBIJMLMNHJJDY-UHFFFAOYSA-N |
| TotalMolweight | 392.285 |
| Molweight | 392.285 |
| MonoisotopicMass | 391.085431 |
| CLogP | 4.0055 |
| CLogS | -4.774 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 293.43 |
| Relative PSA | 0.1689 |
| PolarSurfaceArea | 53.93 |
| Druglikeness | 5.3391 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 7 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-4-(morpholin-4-ylmethyl)benzamide | 2 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-4-(morpholin-4-ylmethyl)benzamide