| MolName | 3-[4-[[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]phenyl]chromen-2-one |
| MolecularFormula | C24H16N2O4 |
| Smiles | [O-][N+](c1cc(/C=C/C=N/c(cc2)ccc2C2=Cc(cccc3)c3OC2=O)ccc1)=O |
| InChI | InChI=1S/C24H16N2O4/c27-24-22(16-19-7-1-2-9-23(19)30-24)18-10-12-20(13-11-18)25-14-4-6-17-5-3-8-21(15-17)26(28)29/h1-16H |
| InChIK | JSIJUGHAMIFZRW-UHFFFAOYSA-N |
| TotalMolweight | 396.401 |
| Molweight | 396.401 |
| MonoisotopicMass | 396.111008 |
| CLogP | 3.2231 |
| CLogS | -5.621 |
| H Acceptors | 6 |
| TotalSurfaceArea | 306.67 |
| Relative PSA | 0.21186 |
| PolarSurfaceArea | 84.48 |
| Druglikeness | -3.9618 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[4-[[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]phenyl]chromen-2-one | 2 - 3-[4-[[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]phenyl]chromen-2-one