| MolName | 5-[[3-[(Z)-1,2,4-triazol-4-yliminomethyl]indol-1-yl]methyl]furan-2-carboxylic acid |
| MolecularFormula | C17H13N5O3 |
| Smiles | OC(c1ccc(Cn2c(cccc3)c3c(/C=N\n3cnnc3)c2)o1)=O |
| InChI | InChI=1S/C17H13N5O3/c23-17(24)16-6-5-13(25-16)9-21-8-12(7-20-22-10-18-19-11-22)14-3-1-2-4-15(14)21/h1-8,10-11H,9H2,(H,23,24) |
| InChIK | JSSBCHSZQCSQCK-UHFFFAOYSA-N |
| TotalMolweight | 335.322 |
| Molweight | 335.322 |
| MonoisotopicMass | 335.10184 |
| CLogP | 1.4858 |
| CLogS | -5.007 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 255.61 |
| Relative PSA | 0.34208 |
| PolarSurfaceArea | 98.44 |
| Druglikeness | 5.0714 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[[3-[(Z)-1,2,4-triazol-4-yliminomethyl]indol-1-yl]methyl]furan-2-carboxylic acid | 2 - 5-[[3-[(Z)-1,2,4-triazol-4-yliminomethyl]indol-1-yl]methyl]furan-2-carboxylic acid