| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-phenylphenyl)methylideneamino]-5-thiophen-2-yltriazole-4-carboxamide |
| MolecularFormula | C22H16N8O2S |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)ccc2-c2ccccc2)=O)c1-c1cccs1 |
| InChI | InChI=1S/C22H16N8O2S/c23-20-21(28-32-27-20)30-19(17-7-4-12-33-17)18(25-29-30)22(31)26-24-13-14-8-10-16(11-9-14)15-5-2-1-3-6-15/h1-13H,(H2,23,27)(H,26,31) |
| InChIK | JSUZRAMAVYJFTH-UHFFFAOYSA-N |
| TotalMolweight | 456.489 |
| Molweight | 456.489 |
| MonoisotopicMass | 456.111692 |
| CLogP | 5.1283 |
| CLogS | -5.213 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 344.66 |
| Relative PSA | 0.39604 |
| PolarSurfaceArea | 165.35 |
| Druglikeness | 3.506 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-phenylphenyl)methylideneamino]-5-thiophen-2-yltriazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(4-phenylphenyl)methylideneamino]-5-thiophen-2-yltriazole-4-carboxamide