| MolName | [4-[(Z)-[[2-[2-[(4-bromophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
| MolecularFormula | C29H20N4O5BrI |
| Smiles | O=C(C(N/N=C\c(cc1)ccc1OC(c(cccc1)c1I)=O)=O)Nc(cccc1)c1C(Nc(cc1)ccc1Br)=O |
| InChI | InChI=1S/C29H20BrIN4O5/c30-19-11-13-20(14-12-19)33-26(36)23-6-2-4-8-25(23)34-27(37)28(38)35-32-17-18-9-15-21(16-10-18)40-29(39)22-5-1-3-7-24(22)31/h1-17H,(H,33,36)(H,34,37)(H,35,38) |
| InChIK | JSVFCCOAQMYDRH-UHFFFAOYSA-N |
| TotalMolweight | 711.305 |
| Molweight | 711.305 |
| MonoisotopicMass | 709.96618 |
| CLogP | 5.8842 |
| CLogS | -8.357 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 437.59 |
| Relative PSA | 0.24692 |
| PolarSurfaceArea | 125.96 |
| Druglikeness | 1.9985 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-[2-[(4-bromophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate | 2 - [4-[(Z)-[[2-[2-[(4-bromophenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-iodobenzoate