| MolName | 3-[[4-chloro-5-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoate |
| MolecularFormula | C23H15N3O5ClS |
| Smiles | [O-]C(c1cccc(CN(C(Cl)=C(/C=N\NC(c2cc3ccccc3cc2O)=O)S2)C2=O)c1)=O |
| InChI | InChI=1S/C23H16ClN3O5S/c24-20-19(33-23(32)27(20)12-13-4-3-7-16(8-13)22(30)31)11-25-26-21(29)17-9-14-5-1-2-6-15(14)10-18(17)28/h1-11,28H,12H2,(H,26,29)(H,30,31)/p-1 |
| InChIK | JTKJNYPWSRXMMI-UHFFFAOYSA-M |
| TotalMolweight | 480.907 |
| Molweight | 480.907 |
| MonoisotopicMass | 480.042094 |
| CLogP | 1.8297 |
| CLogS | -6.651 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 337.36 |
| Relative PSA | 0.32757 |
| PolarSurfaceArea | 147.43 |
| Druglikeness | 7.4464 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[[4-chloro-5-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoate | 2 - 3-[[4-chloro-5-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoate