| MolName | N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| MolecularFormula | C25H25N4O5BrS |
| Smiles | NC(COc1ccc(/C=N\NC(CN(CCc2ccccc2)S(c(cc2)ccc2Br)(=O)=O)=O)cc1)=O |
| InChI | InChI=1S/C25H25BrN4O5S/c26-21-8-12-23(13-9-21)36(33,34)30(15-14-19-4-2-1-3-5-19)17-25(32)29-28-16-20-6-10-22(11-7-20)35-18-24(27)31/h1-13,16H,14-15,17-18H2,(H2,27,31)(H,29,32) |
| InChIK | JTVPDHZOFTWREE-UHFFFAOYSA-N |
| TotalMolweight | 573.467 |
| Molweight | 573.467 |
| MonoisotopicMass | 572.072902 |
| CLogP | 3.3007 |
| CLogS | -4.76 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 395.57 |
| Relative PSA | 0.26911 |
| PolarSurfaceArea | 139.54 |
| Druglikeness | 6.2813 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 11 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 7 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]acetamide | 2 - N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]acetamide