| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1H-indole-2-carboxamide |
| MolecularFormula | C16H11N3OCl2 |
| Smiles | O=C(c1cc(cccc2)c2[nH]1)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C16H11Cl2N3O/c17-12-6-5-11(13(18)8-12)9-19-21-16(22)15-7-10-3-1-2-4-14(10)20-15/h1-9,20H,(H,21,22) |
| InChIK | JUODAEVZDAOLJA-UHFFFAOYSA-N |
| TotalMolweight | 332.189 |
| Molweight | 332.189 |
| MonoisotopicMass | 331.027916 |
| CLogP | 4.507 |
| CLogS | -5.742 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 242 |
| Relative PSA | 0.20661 |
| PolarSurfaceArea | 57.25 |
| Druglikeness | 5.6159 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1H-indole-2-carboxamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1H-indole-2-carboxamide