| MolName | 2-[5-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| MolecularFormula | C26H25N7O3 |
| Smiles | OC(c(cccc1)c1-c1ccc(/C=N\Nc2nc(N3CCCCC3)nc(Nc3ccccc3)n2)o1)=O |
| InChI | InChI=1S/C26H25N7O3/c34-23(35)21-12-6-5-11-20(21)22-14-13-19(36-22)17-27-32-25-29-24(28-18-9-3-1-4-10-18)30-26(31-25)33-15-7-2-8-16-33/h1,3-6,9-14,17H,2,7-8,15-16H2,(H,34,35)(H2,28,29,30,31,32) |
| InChIK | JUOXPPBBZBBDPF-UHFFFAOYSA-N |
| TotalMolweight | 483.531 |
| Molweight | 483.531 |
| MonoisotopicMass | 483.201888 |
| CLogP | 6.5387 |
| CLogS | -7.378 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 375.89 |
| Relative PSA | 0.29567 |
| PolarSurfaceArea | 128.77 |
| Druglikeness | 4.2755 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[5-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzoic acid | 2 - 2-[5-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]furan-2-yl]benzoic acid