| MolName | N-[(Z)-(3-chlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine |
| MolecularFormula | C14H10N3ClS |
| Smiles | Clc1cc(/C=N\Nc2nc(cccc3)c3s2)ccc1 |
| InChI | InChI=1S/C14H10ClN3S/c15-11-5-3-4-10(8-11)9-16-18-14-17-12-6-1-2-7-13(12)19-14/h1-9H,(H,17,18) |
| InChIK | JUVJUTPVQMMEEB-UHFFFAOYSA-N |
| TotalMolweight | 287.773 |
| Molweight | 287.773 |
| MonoisotopicMass | 287.028394 |
| CLogP | 6.2493 |
| CLogS | -4.852 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 213.96 |
| Relative PSA | 0.25379 |
| PolarSurfaceArea | 65.52 |
| Druglikeness | 2.6152 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-chlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine | 2 - N-[(Z)-(3-chlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine