| MolName | N-[(Z)-(3-hydroxyphenyl)methylideneamino]benzenesulfonamide |
| MolecularFormula | C13H12N2O3S |
| Smiles | Oc1cccc(/C=N\NS(c2ccccc2)(=O)=O)c1 |
| InChI | InChI=1S/C13H12N2O3S/c16-12-6-4-5-11(9-12)10-14-15-19(17,18)13-7-2-1-3-8-13/h1-10,15-16H |
| InChIK | JUVQUORYWLFFPT-UHFFFAOYSA-N |
| TotalMolweight | 276.315 |
| Molweight | 276.315 |
| MonoisotopicMass | 276.056863 |
| CLogP | 1.9314 |
| CLogS | -1.62 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 204.17 |
| Relative PSA | 0.31665 |
| PolarSurfaceArea | 87.14 |
| Druglikeness | -4.9782 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-hydroxyphenyl)methylideneamino]benzenesulfonamide | 2 - N-[(Z)-(3-hydroxyphenyl)methylideneamino]benzenesulfonamide