| MolName | 3-[4-[(4-chlorophenyl)methoxy]phenyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C28H21N4O2Cl |
| Smiles | O=C(c1cc(-c(cc2)ccc2OCc(cc2)ccc2Cl)n[nH]1)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C28H21ClN4O2/c29-23-12-8-19(9-13-23)18-35-24-14-10-21(11-15-24)26-16-27(32-31-26)28(34)33-30-17-22-6-3-5-20-4-1-2-7-25(20)22/h1-17H,18H2,(H,31,32)(H,33,34) |
| InChIK | JVFLAYVPPUVJTD-UHFFFAOYSA-N |
| TotalMolweight | 480.954 |
| Molweight | 480.954 |
| MonoisotopicMass | 480.135303 |
| CLogP | 6.0479 |
| CLogS | -7.779 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 368.62 |
| Relative PSA | 0.19253 |
| PolarSurfaceArea | 79.37 |
| Druglikeness | 5.365 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65714 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[4-[(4-chlorophenyl)methoxy]phenyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]-1H-pyrazole-5-carboxamide | 2 - 3-[4-[(4-chlorophenyl)methoxy]phenyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]-1H-pyrazole-5-carboxamide