| MolName | 2-anilino-N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C19H16N3O2Cl |
| Smiles | O=C(CNc1ccccc1)N/N=C\c1ccc(-c(cc2)ccc2Cl)o1 |
| InChI | InChI=1S/C19H16ClN3O2/c20-15-8-6-14(7-9-15)18-11-10-17(25-18)12-22-23-19(24)13-21-16-4-2-1-3-5-16/h1-12,21H,13H2,(H,23,24) |
| InChIK | JVIFDNYNTYUOEA-UHFFFAOYSA-N |
| TotalMolweight | 353.808 |
| Molweight | 353.808 |
| MonoisotopicMass | 353.093104 |
| CLogP | 4.0384 |
| CLogS | -5.739 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 277.08 |
| Relative PSA | 0.22225 |
| PolarSurfaceArea | 66.63 |
| Druglikeness | 7.0424 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-anilino-N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-anilino-N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]acetamide