| MolName | 4-bromo-1-[(4-chlorophenyl)methyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]pyrazole-3-carboxamide |
| MolecularFormula | C18H14N4O2BrCl |
| Smiles | Oc1cccc(/C=N\NC(c2nn(Cc(cc3)ccc3Cl)cc2Br)=O)c1 |
| InChI | InChI=1S/C18H14BrClN4O2/c19-16-11-24(10-12-4-6-14(20)7-5-12)23-17(16)18(26)22-21-9-13-2-1-3-15(25)8-13/h1-9,11,25H,10H2,(H,22,26) |
| InChIK | JVQZLDMEPVRNQK-UHFFFAOYSA-N |
| TotalMolweight | 433.692 |
| Molweight | 433.692 |
| MonoisotopicMass | 431.998864 |
| CLogP | 3.6609 |
| CLogS | -4.576 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 288.87 |
| Relative PSA | 0.23177 |
| PolarSurfaceArea | 79.51 |
| Druglikeness | 1.8817 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-bromo-1-[(4-chlorophenyl)methyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]pyrazole-3-carboxamide | 2 - 4-bromo-1-[(4-chlorophenyl)methyl]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]pyrazole-3-carboxamide