| MolName | N-[(1S)-2-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| MolecularFormula | C24H18N5O3Cl |
| Smiles | O=C([C@H](C(c1c2cccc1)=NNC2=O)NC(c1ccccc1)=O)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C24H18ClN5O3/c25-19-13-7-4-10-16(19)14-26-29-24(33)21(27-22(31)15-8-2-1-3-9-15)20-17-11-5-6-12-18(17)23(32)30-28-20/h1-14,21H,(H,27,31)(H,29,33)(H,30,32)/t21-/m0/s1 |
| InChIK | JVUIUUSXYKVIGM-NRFANRHFSA-N |
| TotalMolweight | 459.892 |
| Molweight | 459.892 |
| MonoisotopicMass | 459.109817 |
| CLogP | 3.7391 |
| CLogS | -6.613 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 342.56 |
| Relative PSA | 0.28176 |
| PolarSurfaceArea | 112.02 |
| Druglikeness | 6.9783 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.45455 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 1 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - N-[(1S)-2-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide | 2 - N-[(1S)-2-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide