| MolName | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[5-chloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C24H22N9O4Cl3 |
| Smiles | Nc1nonc1-n1nnc(CN2CCOCC2)c1C(N/N=C\c(cc(cc1)Cl)c1OCc(c(Cl)ccc1)c1Cl)=O |
| InChI | InChI=1S/C24H22Cl3N9O4/c25-15-4-5-20(39-13-16-17(26)2-1-3-18(16)27)14(10-15)11-29-31-24(37)21-19(12-35-6-8-38-9-7-35)30-34-36(21)23-22(28)32-40-33-23/h1-5,10-11H,6-9,12-13H2,(H2,28,32)(H,31,37) |
| InChIK | JVXWRFNRHFNFKC-UHFFFAOYSA-N |
| TotalMolweight | 606.857 |
| Molweight | 606.857 |
| MonoisotopicMass | 605.086032 |
| CLogP | 4.5074 |
| CLogS | -4.582 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 434.58 |
| Relative PSA | 0.32144 |
| PolarSurfaceArea | 158.81 |
| Druglikeness | 2.4475 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.475 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 9 |
| Symmetricatoms | 5 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[5-chloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide | 2 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[5-chloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide