| MolName | 3-(naphthalen-1-ylmethyl)-4-[(Z)-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C24H17N7O2S2 |
| Smiles | [O-][N+](c(cc(/C=N\N(C(Cc1cccc2ccccc12)=NN1)C1=S)cc1)c1Sc1ncccn1)=O |
| InChI | InChI=1S/C24H17N7O2S2/c32-31(33)20-13-16(9-10-21(20)35-23-25-11-4-12-26-23)15-27-30-22(28-29-24(30)34)14-18-7-3-6-17-5-1-2-8-19(17)18/h1-13,15H,14H2,(H,29,34) |
| InChIK | JWCMKYOYWLDSEJ-UHFFFAOYSA-N |
| TotalMolweight | 499.578 |
| Molweight | 499.578 |
| MonoisotopicMass | 499.088513 |
| CLogP | 4.0912 |
| CLogS | -7.033 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 368.52 |
| Relative PSA | 0.36872 |
| PolarSurfaceArea | 168.98 |
| Druglikeness | -1.2366 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.54286 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(naphthalen-1-ylmethyl)-4-[(Z)-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-(naphthalen-1-ylmethyl)-4-[(Z)-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione