| MolName | N'-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-N-(4-phenoxyphenyl)oxamide |
| MolecularFormula | C25H24N4O4 |
| Smiles | O=C(C(N/N=C\c(cc1)ccc1N1CCOCC1)=O)Nc(cc1)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C25H24N4O4/c30-24(27-20-8-12-23(13-9-20)33-22-4-2-1-3-5-22)25(31)28-26-18-19-6-10-21(11-7-19)29-14-16-32-17-15-29/h1-13,18H,14-17H2,(H,27,30)(H,28,31) |
| InChIK | JWOFJQWZVSLRKH-UHFFFAOYSA-N |
| TotalMolweight | 444.49 |
| Molweight | 444.49 |
| MonoisotopicMass | 444.179756 |
| CLogP | 3.2085 |
| CLogS | -5.925 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 347.8 |
| Relative PSA | 0.24169 |
| PolarSurfaceArea | 92.26 |
| Druglikeness | 4.2639 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.69697 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 8 |
| Amides | 1 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-N-(4-phenoxyphenyl)oxamide | 2 - N'-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-N-(4-phenoxyphenyl)oxamide