| MolName | (Z)-4-(furan-2-yl)-3-[(Z)-furan-2-ylmethylideneamino]-N-(2-phenylethyl)-1,3-thiazol-2-imine |
| MolecularFormula | C20H17N3O2S |
| Smiles | C(C/N=C1\SC=C(c2ccco2)N1/N=C\c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C20H17N3O2S/c1-2-6-16(7-3-1)10-11-21-20-23(22-14-17-8-4-12-24-17)18(15-26-20)19-9-5-13-25-19/h1-9,12-15H,10-11H2 |
| InChIK | JXBMTCILOXKSFL-UHFFFAOYSA-N |
| TotalMolweight | 363.44 |
| Molweight | 363.44 |
| MonoisotopicMass | 363.104147 |
| CLogP | 4.2756 |
| CLogS | -5.271 |
| H Acceptors | 5 |
| TotalSurfaceArea | 286.41 |
| Relative PSA | 0.25237 |
| PolarSurfaceArea | 79.54 |
| Druglikeness | 4.295 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-4-(furan-2-yl)-3-[(Z)-furan-2-ylmethylideneamino]-N-(2-phenylethyl)-1,3-thiazol-2-imine | 2 - (Z)-4-(furan-2-yl)-3-[(Z)-furan-2-ylmethylideneamino]-N-(2-phenylethyl)-1,3-thiazol-2-imine