| MolName | N-[2-oxo-2-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]-2-phenylacetamide |
| MolecularFormula | C15H15N3O2S |
| Smiles | O=C(Cc1ccccc1)NCC(N/N=C\c1cccs1)=O |
| InChI | InChI=1S/C15H15N3O2S/c19-14(9-12-5-2-1-3-6-12)16-11-15(20)18-17-10-13-7-4-8-21-13/h1-8,10H,9,11H2,(H,16,19)(H,18,20) |
| InChIK | JXHBHXVCIGPELG-UHFFFAOYSA-N |
| TotalMolweight | 301.369 |
| Molweight | 301.369 |
| MonoisotopicMass | 301.088497 |
| CLogP | 2.15 |
| CLogS | -3.463 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 239.66 |
| Relative PSA | 0.33744 |
| PolarSurfaceArea | 98.8 |
| Druglikeness | 6.948 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-oxo-2-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]-2-phenylacetamide | 2 - N-[2-oxo-2-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]-2-phenylacetamide