| MolName | 2-phenothiazin-10-yl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C19H15N3OS2 |
| Smiles | O=C(CN1c(cccc2)c2Sc2c1cccc2)N/N=C\c1cccs1 |
| InChI | InChI=1S/C19H15N3OS2/c23-19(21-20-12-14-6-5-11-24-14)13-22-15-7-1-3-9-17(15)25-18-10-4-2-8-16(18)22/h1-12H,13H2,(H,21,23) |
| InChIK | JXPJJKKIFSXDSK-UHFFFAOYSA-N |
| TotalMolweight | 365.48 |
| Molweight | 365.48 |
| MonoisotopicMass | 365.065652 |
| CLogP | 4.9002 |
| CLogS | -6.249 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 270.74 |
| Relative PSA | 0.28592 |
| PolarSurfaceArea | 98.24 |
| Druglikeness | 7.4092 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-phenothiazin-10-yl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide | 2 - 2-phenothiazin-10-yl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide