| MolName | 3-[(Z)-anthracen-9-ylmethylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| MolecularFormula | C25H16N4O2 |
| Smiles | O=C(c([nH]c1c2cccc1)c2NC1=O)N1/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C25H16N4O2/c30-24-23-22(19-11-5-6-12-21(19)27-23)28-25(31)29(24)26-14-20-17-9-3-1-7-15(17)13-16-8-2-4-10-18(16)20/h1-14,27H,(H,28,31) |
| InChIK | JXQNYXSFPQBNFB-UHFFFAOYSA-N |
| TotalMolweight | 404.428 |
| Molweight | 404.428 |
| MonoisotopicMass | 404.127326 |
| CLogP | 4.9052 |
| CLogS | -7.859 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 294.91 |
| Relative PSA | 0.2258 |
| PolarSurfaceArea | 77.56 |
| Druglikeness | 5.2827 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.45161 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 23 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-anthracen-9-ylmethylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione | 2 - 3-[(Z)-anthracen-9-ylmethylideneamino]-1,5-dihydropyrimido[5,4-b]indole-2,4-dione