| MolName | (Z)-1-(3,4-dichlorophenyl)-N-[(Z)-furan-2-ylmethylideneamino]methanimine |
| MolecularFormula | C12H8N2OCl2 |
| Smiles | Clc(ccc(/C=N\N=C/c1ccco1)c1)c1Cl |
| InChI | InChI=1S/C12H8Cl2N2O/c13-11-4-3-9(6-12(11)14)7-15-16-8-10-2-1-5-17-10/h1-8H |
| InChIK | JYKFHHBYHBJJEX-UHFFFAOYSA-N |
| TotalMolweight | 267.115 |
| Molweight | 267.115 |
| MonoisotopicMass | 266.001367 |
| CLogP | 5.1863 |
| CLogS | -5.286 |
| H Acceptors | 3 |
| TotalSurfaceArea | 203.07 |
| Relative PSA | 0.18284 |
| PolarSurfaceArea | 37.86 |
| Druglikeness | 1.3041 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(3,4-dichlorophenyl)-N-[(Z)-furan-2-ylmethylideneamino]methanimine | 2 - (Z)-1-(3,4-dichlorophenyl)-N-[(Z)-furan-2-ylmethylideneamino]methanimine