| MolName | 2-[(Z)-[[2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid |
| MolecularFormula | C24H18N5O3ClS |
| Smiles | OC(c1c(/C=N\NC(CSc2nnc(-c3ccccc3)n2-c(cc2)ccc2Cl)=O)cccc1)=O |
| InChI | InChI=1S/C24H18ClN5O3S/c25-18-10-12-19(13-11-18)30-22(16-6-2-1-3-7-16)28-29-24(30)34-15-21(31)27-26-14-17-8-4-5-9-20(17)23(32)33/h1-14H,15H2,(H,27,31)(H,32,33) |
| InChIK | JYLNAYGPMKWVCZ-UHFFFAOYSA-N |
| TotalMolweight | 491.958 |
| Molweight | 491.958 |
| MonoisotopicMass | 491.081887 |
| CLogP | 4.6229 |
| CLogS | -9.165 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 364 |
| Relative PSA | 0.29794 |
| PolarSurfaceArea | 134.77 |
| Druglikeness | 5.274 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[[2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid | 2 - 2-[(Z)-[[2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid