| MolName | 2-(thiophen-2-ylsulfonylamino)-N-[(Z)-[4-[(Z)-[[2-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]phenyl]methylideneamino]benzamide |
| MolecularFormula | C30H24N6O6S4 |
| Smiles | O=C(c(cccc1)c1NS(c1cccs1)(=O)=O)N/N=C\c1ccc(/C=N\NC(c(cccc2)c2NS(c2cccs2)(=O)=O)=O)cc1 |
| InChI | InChI=1S/C30H24N6O6S4/c37-29(23-7-1-3-9-25(23)35-45(39,40)27-11-5-17-43-27)33-31-19-21-13-15-22(16-14-21)20-32-34-30(38)24-8-2-4-10-26(24)36-46(41,42)28-12-6-18-44-28/h1-20,35-36H,(H,33,37)(H,34,38) |
| InChIK | JYQAMQZUTJTPOY-UHFFFAOYSA-N |
| TotalMolweight | 692.821 |
| Molweight | 692.821 |
| MonoisotopicMass | 692.064014 |
| CLogP | 5.32 |
| CLogS | -8.326 |
| H Acceptors | 12 |
| H Donors | 4 |
| TotalSurfaceArea | 492.2 |
| Relative PSA | 0.39175 |
| PolarSurfaceArea | 248.5 |
| Druglikeness | 6.1158 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56522 |
| Fragments | 1 |
| Non HAtoms | 46 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 2 |
| Symmetricatoms | 25 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(thiophen-2-ylsulfonylamino)-N-[(Z)-[4-[(Z)-[[2-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]phenyl]methylideneamino]benzamide | 2 - 2-(thiophen-2-ylsulfonylamino)-N-[(Z)-[4-[(Z)-[[2-(thiophen-2-ylsulfonylamino)benzoyl]hydrazinylidene]methyl]phenyl]methylideneamino]benzamide