| MolName | (Z)-1-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C20H15N4OCl |
| Smiles | Clc(cc1)cc(/C=N\n2cnnc2)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C20H15ClN4O/c21-18-8-9-20(17(10-18)11-24-25-13-22-23-14-25)26-12-16-6-3-5-15-4-1-2-7-19(15)16/h1-11,13-14H,12H2 |
| InChIK | JYRKOZHVSNVRKD-UHFFFAOYSA-N |
| TotalMolweight | 362.819 |
| Molweight | 362.819 |
| MonoisotopicMass | 362.093438 |
| CLogP | 4.3768 |
| CLogS | -7.993 |
| H Acceptors | 5 |
| TotalSurfaceArea | 278.04 |
| Relative PSA | 0.18098 |
| PolarSurfaceArea | 52.3 |
| Druglikeness | 3.0785 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine