| MolName | 1-N,4-N-bis[(Z)-(2,6-dichlorophenyl)methylideneamino]phthalazine-1,4-diamine |
| MolecularFormula | C22H14N6Cl4 |
| Smiles | Clc1cccc(Cl)c1/C=N\Nc(c1ccccc11)nnc1N/N=C\c(c(Cl)ccc1)c1Cl |
| InChI | InChI=1S/C22H14Cl4N6/c23-17-7-3-8-18(24)15(17)11-27-29-21-13-5-1-2-6-14(13)22(32-31-21)30-28-12-16-19(25)9-4-10-20(16)26/h1-12H,(H,29,31)(H,30,32) |
| InChIK | JZAICKCVNYTOIS-UHFFFAOYSA-N |
| TotalMolweight | 504.207 |
| Molweight | 504.207 |
| MonoisotopicMass | 502.003402 |
| CLogP | 10.514 |
| CLogS | -9.036 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 359.02 |
| Relative PSA | 0.18907 |
| PolarSurfaceArea | 74.56 |
| Druglikeness | 2.3845 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 19 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-N,4-N-bis[(Z)-(2,6-dichlorophenyl)methylideneamino]phthalazine-1,4-diamine | 2 - 1-N,4-N-bis[(Z)-(2,6-dichlorophenyl)methylideneamino]phthalazine-1,4-diamine