| MolName | N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]pyrazine-2-carboxamide |
| MolecularFormula | C26H19N5O |
| Smiles | O=C(c1nccnc1)N/N=C\c(c1c2cccc1)c(-c1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C26H19N5O/c32-26(23-18-27-15-16-28-23)30-29-17-22-21-13-7-8-14-24(21)31(20-11-5-2-6-12-20)25(22)19-9-3-1-4-10-19/h1-18H,(H,30,32) |
| InChIK | JZFMTCWQYGJIJX-UHFFFAOYSA-N |
| TotalMolweight | 417.471 |
| Molweight | 417.471 |
| MonoisotopicMass | 417.15896 |
| CLogP | 4.5058 |
| CLogS | -7.747 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 327.83 |
| Relative PSA | 0.19772 |
| PolarSurfaceArea | 72.17 |
| Druglikeness | 5.4671 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]pyrazine-2-carboxamide | 2 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]pyrazine-2-carboxamide