| MolName | (Z)-1-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C16H10N4OBr2Cl2 |
| Smiles | Clc1cc(Cl)c(COc(c(/C=N\n2cnnc2)cc(Br)c2)c2Br)cc1 |
| InChI | InChI=1S/C16H10Br2Cl2N4O/c17-12-3-11(6-23-24-8-21-22-9-24)16(14(18)4-12)25-7-10-1-2-13(19)5-15(10)20/h1-6,8-9H,7H2 |
| InChIK | JZIRTDVOMPMDPR-UHFFFAOYSA-N |
| TotalMolweight | 504.996 |
| Molweight | 504.996 |
| MonoisotopicMass | 501.859837 |
| CLogP | 5.2388 |
| CLogS | -8.791 |
| H Acceptors | 5 |
| TotalSurfaceArea | 296.12 |
| Relative PSA | 0.16993 |
| PolarSurfaceArea | 52.3 |
| Druglikeness | 1.2885 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(1,2,4-triazol-4-yl)methanimine