| MolName | N'-[(Z)-anthracen-9-ylmethylideneamino]-N-(2-fluorophenyl)oxamide |
| MolecularFormula | C23H16N3O2F |
| Smiles | O=C(C(N/N=C\c1c(cccc2)c2cc2ccccc12)=O)Nc(cccc1)c1F |
| InChI | InChI=1S/C23H16FN3O2/c24-20-11-5-6-12-21(20)26-22(28)23(29)27-25-14-19-17-9-3-1-7-15(17)13-16-8-2-4-10-18(16)19/h1-14H,(H,26,28)(H,27,29) |
| InChIK | JZQQRGJDESLBCT-UHFFFAOYSA-N |
| TotalMolweight | 385.397 |
| Molweight | 385.397 |
| MonoisotopicMass | 385.122655 |
| CLogP | 4.6335 |
| CLogS | -7.051 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 291.75 |
| Relative PSA | 0.2074 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 2.4078 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-anthracen-9-ylmethylideneamino]-N-(2-fluorophenyl)oxamide | 2 - N'-[(Z)-anthracen-9-ylmethylideneamino]-N-(2-fluorophenyl)oxamide