| MolName | 3-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| MolecularFormula | C19H17N3OS |
| Smiles | O=C(c1c(N=C2)sc3c1CCCC3)N2/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C19H17N3OS/c23-19-17-15-10-4-5-11-16(15)24-18(17)20-13-22(19)21-12-6-9-14-7-2-1-3-8-14/h1-3,6-9,12-13H,4-5,10-11H2 |
| InChIK | KAEGEWIEAGTEMW-UHFFFAOYSA-N |
| TotalMolweight | 335.43 |
| Molweight | 335.43 |
| MonoisotopicMass | 335.109232 |
| CLogP | 3.7033 |
| CLogS | -5.343 |
| H Acceptors | 4 |
| TotalSurfaceArea | 261.07 |
| Relative PSA | 0.22971 |
| PolarSurfaceArea | 73.27 |
| Druglikeness | 1.3358 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one