| MolName | N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]benzenesulfonamide |
| MolecularFormula | C15H17N3O3S2 |
| Smiles | O=S(c1ccccc1)(N/N=C\c1ccc(N2CCOCC2)s1)=O |
| InChI | InChI=1S/C15H17N3O3S2/c19-23(20,14-4-2-1-3-5-14)17-16-12-13-6-7-15(22-13)18-8-10-21-11-9-18/h1-7,12,17H,8-11H2 |
| InChIK | KAKFINDJEYVJEM-UHFFFAOYSA-N |
| TotalMolweight | 351.45 |
| Molweight | 351.45 |
| MonoisotopicMass | 351.071132 |
| CLogP | 2.0023 |
| CLogS | -2.179 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 255.6 |
| Relative PSA | 0.33435 |
| PolarSurfaceArea | 107.62 |
| Druglikeness | -2.4305 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]benzenesulfonamide | 2 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]benzenesulfonamide