| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3-chlorophenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide |
| MolecularFormula | C19H15N8O2ClS |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cccc(Cl)c2)=O)c1CSc1ccccc1 |
| InChI | InChI=1S/C19H15ClN8O2S/c20-13-6-4-5-12(9-13)10-22-24-19(29)16-15(11-31-14-7-2-1-3-8-14)28(27-23-16)18-17(21)25-30-26-18/h1-10H,11H2,(H2,21,25)(H,24,29) |
| InChIK | KAKVOZARQIMFNL-UHFFFAOYSA-N |
| TotalMolweight | 454.901 |
| Molweight | 454.901 |
| MonoisotopicMass | 454.072719 |
| CLogP | 4.3168 |
| CLogS | -4.617 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 335.63 |
| Relative PSA | 0.39815 |
| PolarSurfaceArea | 162.41 |
| Druglikeness | 2.2982 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3-chlorophenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(3-chlorophenyl)methylideneamino]-5-(phenylsulfanylmethyl)triazole-4-carboxamide