| MolName | 1-(2-fluorophenyl)-3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]thiourea |
| MolecularFormula | C21H20N5OFS2 |
| Smiles | Fc(cccc1)c1NC(N/N=C\c1c(-c2ccccc2)nc(N2CCOCC2)s1)=S |
| InChI | InChI=1S/C21H20FN5OS2/c22-16-8-4-5-9-17(16)24-20(29)26-23-14-18-19(15-6-2-1-3-7-15)25-21(30-18)27-10-12-28-13-11-27/h1-9,14H,10-13H2,(H2,24,26,29) |
| InChIK | KAORFVRWZFPOJO-UHFFFAOYSA-N |
| TotalMolweight | 441.554 |
| Molweight | 441.554 |
| MonoisotopicMass | 441.109328 |
| CLogP | 4.8197 |
| CLogS | -6.359 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 336.06 |
| Relative PSA | 0.31932 |
| PolarSurfaceArea | 122.11 |
| Druglikeness | 3.3777 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2-fluorophenyl)-3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]thiourea | 2 - 1-(2-fluorophenyl)-3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]thiourea