| MolName | 3-[(Z)-(2-chlorophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| MolecularFormula | C10H7N2OClS2 |
| Smiles | O=C(CSC1=S)N1/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C10H7ClN2OS2/c11-8-4-2-1-3-7(8)5-12-13-9(14)6-16-10(13)15/h1-5H,6H2 |
| InChIK | KAQQUTMMRWRQSO-UHFFFAOYSA-N |
| TotalMolweight | 270.764 |
| Molweight | 270.764 |
| MonoisotopicMass | 269.96883 |
| CLogP | 1.5478 |
| CLogS | -4.001 |
| H Acceptors | 3 |
| TotalSurfaceArea | 191.95 |
| Relative PSA | 0.38338 |
| PolarSurfaceArea | 90.06 |
| Druglikeness | 3.8236 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(2-chlorophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one | 2 - 3-[(Z)-(2-chlorophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one