| MolName | 3-[5-[(Z)-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]iminomethyl]furan-2-yl]benzoic acid |
| MolecularFormula | C30H20N2O5 |
| Smiles | OC(c1cccc(-c2ccc(/C=N\N(C([C@H]([C@H]3C4c5c6cccc5)C6c5c4cccc5)=O)C3=O)o2)c1)=O |
| InChI | InChI=1S/C30H20N2O5/c33-28-26-24-19-8-1-2-9-20(19)25(22-11-4-3-10-21(22)24)27(26)29(34)32(28)31-15-18-12-13-23(37-18)16-6-5-7-17(14-16)30(35)36/h1-15,24-27H,(H,35,36)/t24?,25?,26-,27-/m1/s1 |
| InChIK | KBCMXYWNHHXGEQ-ATEVHTGXSA-N |
| TotalMolweight | 488.498 |
| Molweight | 488.498 |
| MonoisotopicMass | 488.137223 |
| CLogP | 3.5269 |
| CLogS | -6.603 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 346.39 |
| Relative PSA | 0.23497 |
| PolarSurfaceArea | 100.18 |
| Druglikeness | 6.9468 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.45946 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 2 |
| Rotatable Bond | 4 |
| Rings Closures | 7 |
| Small Rings | 8 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| AcidicOxygens | 1 |
| StereoCon | meso |
Click to Load Molecule:
1 - 3-[5-[(Z)-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]iminomethyl]furan-2-yl]benzoic acid | 2 - 3-[5-[(Z)-[(15S,19R)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]iminomethyl]furan-2-yl]benzoic acid