| MolName | 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C22H19N3O4Cl2S |
| Smiles | Oc1cccc(/C=N\NC(CN(Cc2cccc(Cl)c2)S(c(cc2)ccc2Cl)(=O)=O)=O)c1 |
| InChI | InChI=1S/C22H19Cl2N3O4S/c23-18-7-9-21(10-8-18)32(30,31)27(14-17-4-1-5-19(24)11-17)15-22(29)26-25-13-16-3-2-6-20(28)12-16/h1-13,28H,14-15H2,(H,26,29) |
| InChIK | KBGLJLKTRFTESO-UHFFFAOYSA-N |
| TotalMolweight | 492.382 |
| Molweight | 492.382 |
| MonoisotopicMass | 491.047331 |
| CLogP | 4.3495 |
| CLogS | -5.121 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 350.34 |
| Relative PSA | 0.23189 |
| PolarSurfaceArea | 107.45 |
| Druglikeness | 7.3052 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide | 2 - 2-[(3-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[(Z)-(3-hydroxyphenyl)methylideneamino]acetamide