| MolName | N-[(Z)-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-cyanoacetamide |
| MolecularFormula | C14H9N3O2BrClS |
| Smiles | N#CCC(N/N=C\c(o1)cc(Br)c1Sc(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C14H9BrClN3O2S/c15-12-7-10(8-18-19-13(20)5-6-17)21-14(12)22-11-3-1-9(16)2-4-11/h1-4,7-8H,5H2,(H,19,20) |
| InChIK | KBIHDOVKYVFLMN-UHFFFAOYSA-N |
| TotalMolweight | 398.667 |
| Molweight | 398.667 |
| MonoisotopicMass | 396.928735 |
| CLogP | 3.8962 |
| CLogS | -5.77 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 263.69 |
| Relative PSA | 0.30782 |
| PolarSurfaceArea | 103.69 |
| Druglikeness | -7.7965 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-cyanoacetamide | 2 - N-[(Z)-[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]-2-cyanoacetamide