| MolName | N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-naphthalen-1-ylacetamide |
| MolecularFormula | C20H15N2O3Cl |
| Smiles | O=C(Cc1cccc2ccccc12)N/N=C\c(cc1OCOc1c1)c1Cl |
| InChI | InChI=1S/C20H15ClN2O3/c21-17-10-19-18(25-12-26-19)8-15(17)11-22-23-20(24)9-14-6-3-5-13-4-1-2-7-16(13)14/h1-8,10-11H,9,12H2,(H,23,24) |
| InChIK | KBMIHJZSNBYSFV-UHFFFAOYSA-N |
| TotalMolweight | 366.803 |
| Molweight | 366.803 |
| MonoisotopicMass | 366.07712 |
| CLogP | 5.1115 |
| CLogS | -6.739 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 271.03 |
| Relative PSA | 0.20666 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | 4.2354 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-naphthalen-1-ylacetamide | 2 - N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-naphthalen-1-ylacetamide