| MolName | 2-[4-[(Z)-(benzenesulfonylhydrazinylidene)methyl]phenoxy]acetate |
| MolecularFormula | C15H13N2O5S |
| Smiles | [O-]C(COc1ccc(/C=N\NS(c2ccccc2)(=O)=O)cc1)=O |
| InChI | InChI=1S/C15H14N2O5S/c18-15(19)11-22-13-8-6-12(7-9-13)10-16-17-23(20,21)14-4-2-1-3-5-14/h1-10,17H,11H2,(H,18,19)/p-1 |
| InChIK | KCBAQQOOIWPYMN-UHFFFAOYSA-M |
| TotalMolweight | 333.343 |
| Molweight | 333.343 |
| MonoisotopicMass | 333.054518 |
| CLogP | -0.7389 |
| CLogS | -1.709 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 246.86 |
| Relative PSA | 0.36 |
| PolarSurfaceArea | 116.27 |
| Druglikeness | -3.8743 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 5 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-(benzenesulfonylhydrazinylidene)methyl]phenoxy]acetate | 2 - 2-[4-[(Z)-(benzenesulfonylhydrazinylidene)methyl]phenoxy]acetate