| MolName | 3-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| MolecularFormula | C22H23N3O3 |
| Smiles | O=C(C1(CCCCC1)NC1=O)N1/N=C\c(cccc1)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H23N3O3/c26-20-22(13-7-2-8-14-22)24-21(27)25(20)23-15-18-11-5-6-12-19(18)28-16-17-9-3-1-4-10-17/h1,3-6,9-12,15H,2,7-8,13-14,16H2,(H,24,27) |
| InChIK | KCIFIHDEUKTXGQ-UHFFFAOYSA-N |
| TotalMolweight | 377.443 |
| Molweight | 377.443 |
| MonoisotopicMass | 377.173942 |
| CLogP | 3.4989 |
| CLogS | -5.077 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 291.01 |
| Relative PSA | 0.21511 |
| PolarSurfaceArea | 71 |
| Druglikeness | 1.3269 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione | 2 - 3-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione