| MolName | N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-4-[(2Z)-2-[(E)-3-(2-nitrophenyl)prop-2-enylidene]hydrazinyl]benzamide |
| MolecularFormula | C25H20N6O5 |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(c(cc2)ccc2N/N=C\C=C\c(cccc2)c2[N+]([O-])=O)=O)cccc1)=O |
| InChI | InChI=1S/C25H20N6O5/c32-25(29-27-18-6-10-20-8-2-4-12-24(20)31(35)36)21-13-15-22(16-14-21)28-26-17-5-9-19-7-1-3-11-23(19)30(33)34/h1-18,28H,(H,29,32) |
| InChIK | KCZGNBGUQIFWTD-UHFFFAOYSA-N |
| TotalMolweight | 484.471 |
| Molweight | 484.471 |
| MonoisotopicMass | 484.149519 |
| CLogP | 4.5763 |
| CLogS | -6.758 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 383.31 |
| Relative PSA | 0.31259 |
| PolarSurfaceArea | 157.49 |
| Druglikeness | -0.71953 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63889 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-4-[(2Z)-2-[(E)-3-(2-nitrophenyl)prop-2-enylidene]hydrazinyl]benzamide | 2 - N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-4-[(2Z)-2-[(E)-3-(2-nitrophenyl)prop-2-enylidene]hydrazinyl]benzamide